C7H15F3N4 — CID 104882060
3-amino-2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine (PubChem CID 104882060) has the molecular formula C7H15F3N4 and a molecular weight of 212.22 g/mol. Its IUPAC name is 3-amino-2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 3-amino-2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 104882060 |
| Molecular Formula | C7H15F3N4 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 3-amino-2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine |
| SMILES | CCCN(CC(F)(F)F)/C(=N/C)NN |
| InChI | InChI=1S/C7H15F3N4/c1-3-4-14(5-7(8,9)10)6(12-2)13-11/h3-5,11H2,1-2H3,(H,12,13) |
| InChIKey | CEOHUJVQCLJUCK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|