About N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide
N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide (PubChem CID 104882079) has the molecular formula C6H14N4OS
and a molecular weight of 190.27 g/mol. Its IUPAC name is N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide.
Molecular Properties
| Compound Name | N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide |
| PubChem CID | 104882079 |
| Molecular Formula | C6H14N4OS |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide |
| SMILES | C/N=C(\NN)N1CCS(=O)CC1 |
| InChI | InChI=1S/C6H14N4OS/c1-8-6(9-7)10-2-4-12(11)5-3-10/h2-5,7H2,1H3,(H,8,9) |
| InChIKey | QDJOISBWPOHGDR-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide?
The IUPAC name of N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide (CID 104882079) is N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide.
What is the SMILES notation for N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide?
The canonical SMILES for N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide is C/N=C(\NN)N1CCS(=O)CC1.
What is the InChIKey of N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide?
The InChIKey is QDJOISBWPOHGDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N4OS/c1-8-6(9-7)10-2-4-12(11)5-3-10/h2-5,7H2,1H3,(H,8,9).
What are the key properties of N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide?
N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide has a molecular weight of 190.27 g/mol, XLogP of -1.50, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N'-methyl-1-oxo-1,4-thiazinane-4-carboximidamide is sourced from PubChem (CID 104882079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).