C10H21N5 — CID 104882139
1-amino-3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2-methylguanidine (PubChem CID 104882139) has the molecular formula C10H21N5 and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-amino-3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2-methylguanidine.
| Compound Name | 1-amino-3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 104882139 |
| Molecular Formula | C10H21N5 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | 1-amino-3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2-methylguanidine |
| SMILES | C/N=C(\NN)NC1CCN2CCCCC12 |
| InChI | InChI=1S/C10H21N5/c1-12-10(14-11)13-8-5-7-15-6-3-2-4-9(8)15/h8-9H,2-7,11H2,1H3,(H2,12,13,14) |
| InChIKey | KNDLHIKONABKFZ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|