C9H21N5O — CID 104882166
1-amino-2-methyl-3-(1-morpholin-4-ylpropan-2-yl)guanidine (PubChem CID 104882166) has the molecular formula C9H21N5O and a molecular weight of 215.30 g/mol. Its IUPAC name is 1-amino-2-methyl-3-(1-morpholin-4-ylpropan-2-yl)guanidine.
| Compound Name | 1-amino-2-methyl-3-(1-morpholin-4-ylpropan-2-yl)guanidine |
|---|---|
| PubChem CID | 104882166 |
| Molecular Formula | C9H21N5O |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1-amino-2-methyl-3-(1-morpholin-4-ylpropan-2-yl)guanidine |
| SMILES | C/N=C(\NN)NC(C)CN1CCOCC1 |
| InChI | InChI=1S/C9H21N5O/c1-8(12-9(11-2)13-10)7-14-3-5-15-6-4-14/h8H,3-7,10H2,1-2H3,(H2,11,12,13) |
| InChIKey | HBDSHOIWLWOASZ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|