About 3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine
3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine (PubChem CID 104882200) has the molecular formula C7H18N4O
and a molecular weight of 174.25 g/mol. Its IUPAC name is 3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine.
Molecular Properties
| Compound Name | 3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine |
| PubChem CID | 104882200 |
| Molecular Formula | C7H18N4O |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | 3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine |
| SMILES | C/N=C(\NN)N(C)CCCOC |
| InChI | InChI=1S/C7H18N4O/c1-9-7(10-8)11(2)5-4-6-12-3/h4-6,8H2,1-3H3,(H,9,10) |
| InChIKey | WAOFHGNXEHCCPU-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine?
The IUPAC name of 3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine (CID 104882200) is 3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine.
What is the SMILES notation for 3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine?
The canonical SMILES for 3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine is C/N=C(\NN)N(C)CCCOC.
What is the InChIKey of 3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine?
The InChIKey is WAOFHGNXEHCCPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N4O/c1-9-7(10-8)11(2)5-4-6-12-3/h4-6,8H2,1-3H3,(H,9,10).
What are the key properties of 3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine?
3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine has a molecular weight of 174.25 g/mol, XLogP of -0.60, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(3-methoxypropyl)-1,2-dimethylguanidine is sourced from PubChem (CID 104882200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).