About 1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine
1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine (PubChem CID 104882347) has the molecular formula C10H22N4
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine.
Molecular Properties
| Compound Name | 1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine |
| PubChem CID | 104882347 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine |
| SMILES | C/N=C(\NN)NC1CCCCC1(C)C |
| InChI | InChI=1S/C10H22N4/c1-10(2)7-5-4-6-8(10)13-9(12-3)14-11/h8H,4-7,11H2,1-3H3,(H2,12,13,14) |
| InChIKey | SVJUQZRVXNSKRG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine?
The IUPAC name of 1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine (CID 104882347) is 1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine.
What is the SMILES notation for 1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine?
The canonical SMILES for 1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine is C/N=C(\NN)NC1CCCCC1(C)C.
What is the InChIKey of 1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine?
The InChIKey is SVJUQZRVXNSKRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N4/c1-10(2)7-5-4-6-8(10)13-9(12-3)14-11/h8H,4-7,11H2,1-3H3,(H2,12,13,14).
What are the key properties of 1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine?
1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine has a molecular weight of 198.31 g/mol, XLogP of 0.99, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(2,2-dimethylcyclohexyl)-2-methylguanidine is sourced from PubChem (CID 104882347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).