About 1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine
1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine (PubChem CID 104882359) has the molecular formula C7H16N4O2S
and a molecular weight of 220.30 g/mol. Its IUPAC name is 1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine.
Molecular Properties
| Compound Name | 1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine |
| PubChem CID | 104882359 |
| Molecular Formula | C7H16N4O2S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NN)NCC1CCCS1(=O)=O |
| InChI | InChI=1S/C7H16N4O2S/c1-9-7(11-8)10-5-6-3-2-4-14(6,12)13/h6H,2-5,8H2,1H3,(H2,9,10,11) |
| InChIKey | MMUMLFQMCVDVLM-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine?
The IUPAC name of 1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine (CID 104882359) is 1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine.
What is the SMILES notation for 1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine?
The canonical SMILES for 1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine is C/N=C(\NN)NCC1CCCS1(=O)=O.
What is the InChIKey of 1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine?
The InChIKey is MMUMLFQMCVDVLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N4O2S/c1-9-7(11-8)10-5-6-3-2-4-14(6,12)13/h6H,2-5,8H2,1H3,(H2,9,10,11).
What are the key properties of 1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine?
1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine has a molecular weight of 220.30 g/mol, XLogP of -1.40, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-[(1,1-dioxothiolan-2-yl)methyl]-2-methylguanidine is sourced from PubChem (CID 104882359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).