About N,N'-ditert-butyl-2-methylpropane-1,3-diamine
N,N'-ditert-butyl-2-methylpropane-1,3-diamine (PubChem CID 10488274) has the molecular formula C12H28N2
and a molecular weight of 200.37 g/mol. Its IUPAC name is N,N'-ditert-butyl-2-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N,N'-ditert-butyl-2-methylpropane-1,3-diamine |
| PubChem CID | 10488274 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | N,N'-ditert-butyl-2-methylpropane-1,3-diamine |
| SMILES | CC(CNC(C)(C)C)CNC(C)(C)C |
| InChI | InChI=1S/C12H28N2/c1-10(8-13-11(2,3)4)9-14-12(5,6)7/h10,13-14H,8-9H2,1-7H3 |
| InChIKey | OHZGURUEOZAHTL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N'-ditert-butyl-2-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-ditert-butyl-2-methylpropane-1,3-diamine?
The IUPAC name of N,N'-ditert-butyl-2-methylpropane-1,3-diamine (CID 10488274) is N,N'-ditert-butyl-2-methylpropane-1,3-diamine.
What is the SMILES notation for N,N'-ditert-butyl-2-methylpropane-1,3-diamine?
The canonical SMILES for N,N'-ditert-butyl-2-methylpropane-1,3-diamine is CC(CNC(C)(C)C)CNC(C)(C)C.
What is the InChIKey of N,N'-ditert-butyl-2-methylpropane-1,3-diamine?
The InChIKey is OHZGURUEOZAHTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N2/c1-10(8-13-11(2,3)4)9-14-12(5,6)7/h10,13-14H,8-9H2,1-7H3.
What are the key properties of N,N'-ditert-butyl-2-methylpropane-1,3-diamine?
N,N'-ditert-butyl-2-methylpropane-1,3-diamine has a molecular weight of 200.37 g/mol, XLogP of 2.40, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-ditert-butyl-2-methylpropane-1,3-diamine is sourced from PubChem (CID 10488274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).