C13H14O2 — CID 10488325
(4aR,10bS)-3,4,4a,5,6,10b-hexahydrobenzo[h]chromen-2-one (PubChem CID 10488325) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (4aR,10bS)-3,4,4a,5,6,10b-hexahydrobenzo[h]chromen-2-one.
| Compound Name | (4aR,10bS)-3,4,4a,5,6,10b-hexahydrobenzo[h]chromen-2-one |
|---|---|
| PubChem CID | 10488325 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (4aR,10bS)-3,4,4a,5,6,10b-hexahydrobenzo[h]chromen-2-one |
| SMILES | O=C1CC[C@H]2CCc3ccccc3[C@H]2O1 |
| InChI | InChI=1S/C13H14O2/c14-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)15-12/h1-4,10,13H,5-8H2/t10-,13+/m1/s1 |
| InChIKey | JMSDEBGLMQKUIE-MFKMUULPSA-N |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |