About 3-amino-1,1,2-tripropylguanidine
3-amino-1,1,2-tripropylguanidine (PubChem CID 104883381) has the molecular formula C10H24N4
and a molecular weight of 200.33 g/mol. Its IUPAC name is 3-amino-1,1,2-tripropylguanidine.
Molecular Properties
| Compound Name | 3-amino-1,1,2-tripropylguanidine |
| PubChem CID | 104883381 |
| Molecular Formula | C10H24N4 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.20 |
| IUPAC Name | 3-amino-1,1,2-tripropylguanidine |
| SMILES | CCC/N=C(/NN)N(CCC)CCC |
| InChI | InChI=1S/C10H24N4/c1-4-7-12-10(13-11)14(8-5-2)9-6-3/h4-9,11H2,1-3H3,(H,12,13) |
| InChIKey | MSDUAVGMSOKSSS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1,1,2-tripropylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,1,2-tripropylguanidine?
The IUPAC name of 3-amino-1,1,2-tripropylguanidine (CID 104883381) is 3-amino-1,1,2-tripropylguanidine.
What is the SMILES notation for 3-amino-1,1,2-tripropylguanidine?
The canonical SMILES for 3-amino-1,1,2-tripropylguanidine is CCC/N=C(/NN)N(CCC)CCC.
What is the InChIKey of 3-amino-1,1,2-tripropylguanidine?
The InChIKey is MSDUAVGMSOKSSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N4/c1-4-7-12-10(13-11)14(8-5-2)9-6-3/h4-9,11H2,1-3H3,(H,12,13).
What are the key properties of 3-amino-1,1,2-tripropylguanidine?
3-amino-1,1,2-tripropylguanidine has a molecular weight of 200.33 g/mol, XLogP of 1.34, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,1,2-tripropylguanidine is sourced from PubChem (CID 104883381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).