About 3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine
3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine (PubChem CID 104883382) has the molecular formula C11H26N4O
and a molecular weight of 230.36 g/mol. Its IUPAC name is 3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine.
Molecular Properties
| Compound Name | 3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine |
| PubChem CID | 104883382 |
| Molecular Formula | C11H26N4O |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | 3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine |
| SMILES | CCCN(CCC)/C(=N\CCCOC)NN |
| InChI | InChI=1S/C11H26N4O/c1-4-8-15(9-5-2)11(14-12)13-7-6-10-16-3/h4-10,12H2,1-3H3,(H,13,14) |
| InChIKey | WNHMDIAZXKMXMN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine?
The IUPAC name of 3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine (CID 104883382) is 3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine.
What is the SMILES notation for 3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine?
The canonical SMILES for 3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine is CCCN(CCC)/C(=N\CCCOC)NN.
What is the InChIKey of 3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine?
The InChIKey is WNHMDIAZXKMXMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N4O/c1-4-8-15(9-5-2)11(14-12)13-7-6-10-16-3/h4-10,12H2,1-3H3,(H,13,14).
What are the key properties of 3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine?
3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine has a molecular weight of 230.36 g/mol, XLogP of 0.96, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(3-methoxypropyl)-1,1-dipropylguanidine is sourced from PubChem (CID 104883382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).