C13H18N2 — CID 10488339
5,6,6a,7,8,9,10,11-octahydroazepino[1,2-a]quinoxaline (PubChem CID 10488339) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 5,6,6a,7,8,9,10,11-octahydroazepino[1,2-a]quinoxaline.
| Compound Name | 5,6,6a,7,8,9,10,11-octahydroazepino[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 10488339 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 5,6,6a,7,8,9,10,11-octahydroazepino[1,2-a]quinoxaline |
| SMILES | c1ccc2c(c1)NCC1CCCCCN21 |
| InChI | InChI=1S/C13H18N2/c1-2-6-11-10-14-12-7-3-4-8-13(12)15(11)9-5-1/h3-4,7-8,11,14H,1-2,5-6,9-10H2 |
| InChIKey | DXVOPCXXRNAZOS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |