C9H17NO4 — CID 10488362
(1S,6S,7R,8R,8aR)-8-methoxy-1,2,3,5,6,7,8,8a-octahydroindolizine-1,6,7-triol (PubChem CID 10488362) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is (1S,6S,7R,8R,8aR)-8-methoxy-1,2,3,5,6,7,8,8a-octahydroindolizine-1,6,7-triol.
| Compound Name | (1S,6S,7R,8R,8aR)-8-methoxy-1,2,3,5,6,7,8,8a-octahydroindolizine-1,6,7-triol |
|---|---|
| PubChem CID | 10488362 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (1S,6S,7R,8R,8aR)-8-methoxy-1,2,3,5,6,7,8,8a-octahydroindolizine-1,6,7-triol |
| SMILES | CO[C@H]1[C@H](O)[C@@H](O)CN2CC[C@H](O)[C@H]12 |
| InChI | InChI=1S/C9H17NO4/c1-14-9-7-5(11)2-3-10(7)4-6(12)8(9)13/h5-9,11-13H,2-4H2,1H3/t5-,6-,7+,8+,9+/m0/s1 |
| InChIKey | XJCVSLVVHTZUMX-OFPUPOEVSA-N |
| XLogP | -1.83 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |