C8H16N2O4 — CID 10488407
(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-N,6-dimethylpiperidine-2-carboxamide (PubChem CID 10488407) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-3,4,5-trihydroxy-N,6-dimethylpiperidine-2-carboxamide.
| Compound Name | (2S,3S,4R,5S,6S)-3,4,5-trihydroxy-N,6-dimethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 10488407 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | (2S,3S,4R,5S,6S)-3,4,5-trihydroxy-N,6-dimethylpiperidine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1N[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H16N2O4/c1-3-5(11)7(13)6(12)4(10-3)8(14)9-2/h3-7,10-13H,1-2H3,(H,9,14)/t3-,4-,5-,6-,7+/m0/s1 |
| InChIKey | YSHAHRDDTMDOSP-AZEWMMITSA-N |
| XLogP | -2.82 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |