C9H17F3N4 — CID 104884161
3-amino-2-cyclopentyl-1-methyl-1-(2,2,2-trifluoroethyl)guanidine (PubChem CID 104884161) has the molecular formula C9H17F3N4 and a molecular weight of 238.26 g/mol. Its IUPAC name is 3-amino-2-cyclopentyl-1-methyl-1-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 3-amino-2-cyclopentyl-1-methyl-1-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 104884161 |
| Molecular Formula | C9H17F3N4 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 3-amino-2-cyclopentyl-1-methyl-1-(2,2,2-trifluoroethyl)guanidine |
| SMILES | CN(CC(F)(F)F)/C(=N/C1CCCC1)NN |
| InChI | InChI=1S/C9H17F3N4/c1-16(6-9(10,11)12)8(15-13)14-7-4-2-3-5-7/h7H,2-6,13H2,1H3,(H,14,15) |
| InChIKey | VYPHCTMCECWHRS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|