C10H21F3N4O — CID 104884427
3-amino-2-(3-methoxypropyl)-1-propan-2-yl-1-(2,2,2-trifluoroethyl)guanidine (PubChem CID 104884427) has the molecular formula C10H21F3N4O and a molecular weight of 270.30 g/mol. Its IUPAC name is 3-amino-2-(3-methoxypropyl)-1-propan-2-yl-1-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 3-amino-2-(3-methoxypropyl)-1-propan-2-yl-1-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 104884427 |
| Molecular Formula | C10H21F3N4O |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 3-amino-2-(3-methoxypropyl)-1-propan-2-yl-1-(2,2,2-trifluoroethyl)guanidine |
| SMILES | COCCC/N=C(\NN)N(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C10H21F3N4O/c1-8(2)17(7-10(11,12)13)9(16-14)15-5-4-6-18-3/h8H,4-7,14H2,1-3H3,(H,15,16) |
| InChIKey | QBTUDDRVSNRLKC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|