C13H28N4 — CID 104884499
3-amino-2-cyclopentyl-1-(3,3-dimethylbutan-2-yl)-1-methylguanidine (PubChem CID 104884499) has the molecular formula C13H28N4 and a molecular weight of 240.39 g/mol. Its IUPAC name is 3-amino-2-cyclopentyl-1-(3,3-dimethylbutan-2-yl)-1-methylguanidine.
| Compound Name | 3-amino-2-cyclopentyl-1-(3,3-dimethylbutan-2-yl)-1-methylguanidine |
|---|---|
| PubChem CID | 104884499 |
| Molecular Formula | C13H28N4 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | 3-amino-2-cyclopentyl-1-(3,3-dimethylbutan-2-yl)-1-methylguanidine |
| SMILES | CC(N(C)/C(=N/C1CCCC1)NN)C(C)(C)C |
| InChI | InChI=1S/C13H28N4/c1-10(13(2,3)4)17(5)12(16-14)15-11-8-6-7-9-11/h10-11H,6-9,14H2,1-5H3,(H,15,16) |
| InChIKey | VFZGHYILQNYUMG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|