C12H18N2O — CID 10488508
2,2,6,7-tetramethyl-3H-1-benzofuran-4,5-diamine (PubChem CID 10488508) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2,2,6,7-tetramethyl-3H-1-benzofuran-4,5-diamine.
| Compound Name | 2,2,6,7-tetramethyl-3H-1-benzofuran-4,5-diamine |
|---|---|
| PubChem CID | 10488508 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2,2,6,7-tetramethyl-3H-1-benzofuran-4,5-diamine |
| SMILES | Cc1c(C)c2c(c(N)c1N)CC(C)(C)O2 |
| InChI | InChI=1S/C12H18N2O/c1-6-7(2)11-8(10(14)9(6)13)5-12(3,4)15-11/h5,13-14H2,1-4H3 |
| InChIKey | GDVAPUIOQMHZIC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|