About 1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine
1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 104885800) has the molecular formula C8H17F3N4
and a molecular weight of 226.25 g/mol. Its IUPAC name is 1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine.
Molecular Properties
| Compound Name | 1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine |
| PubChem CID | 104885800 |
| Molecular Formula | C8H17F3N4 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCCC/N=C(\NN)NCCC(F)(F)F |
| InChI | InChI=1S/C8H17F3N4/c1-2-3-5-13-7(15-12)14-6-4-8(9,10)11/h2-6,12H2,1H3,(H2,13,14,15) |
| InChIKey | RLCUUWRNZHKKRV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine?
The IUPAC name of 1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine (CID 104885800) is 1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine.
What is the SMILES notation for 1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine?
The canonical SMILES for 1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine is CCCC/N=C(\NN)NCCC(F)(F)F.
What is the InChIKey of 1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine?
The InChIKey is RLCUUWRNZHKKRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F3N4/c1-2-3-5-13-7(15-12)14-6-4-8(9,10)11/h2-6,12H2,1H3,(H2,13,14,15).
What are the key properties of 1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine?
1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine has a molecular weight of 226.25 g/mol, XLogP of 1.15, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-butyl-3-(3,3,3-trifluoropropyl)guanidine is sourced from PubChem (CID 104885800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).