C12H24N4 — CID 104885819
1-amino-3-cyclopropyl-2-[(4-methylcyclohexyl)methyl]guanidine (PubChem CID 104885819) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-amino-3-cyclopropyl-2-[(4-methylcyclohexyl)methyl]guanidine.
| Compound Name | 1-amino-3-cyclopropyl-2-[(4-methylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 104885819 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 1-amino-3-cyclopropyl-2-[(4-methylcyclohexyl)methyl]guanidine |
| SMILES | CC1CCC(C/N=C(\NN)NC2CC2)CC1 |
| InChI | InChI=1S/C12H24N4/c1-9-2-4-10(5-3-9)8-14-12(16-13)15-11-6-7-11/h9-11H,2-8,13H2,1H3,(H2,14,15,16) |
| InChIKey | TUTQFAYZDXPSAX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|