About N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide
N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide (PubChem CID 104885933) has the molecular formula C12H22F3N5
and a molecular weight of 293.34 g/mol. Its IUPAC name is N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide.
Molecular Properties
| Compound Name | N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
| PubChem CID | 104885933 |
| Molecular Formula | C12H22F3N5 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
| SMILES | NN/C(=N\C1CCCC1)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3N5/c13-12(14,15)9-19-5-7-20(8-6-19)11(18-16)17-10-3-1-2-4-10/h10H,1-9,16H2,(H,17,18) |
| InChIKey | XHWHHVZOFLVYKE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide?
The IUPAC name of N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide (CID 104885933) is N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide.
What is the SMILES notation for N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide?
The canonical SMILES for N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide is NN/C(=N\C1CCCC1)N1CCN(CC(F)(F)F)CC1.
What is the InChIKey of N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide?
The InChIKey is XHWHHVZOFLVYKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3N5/c13-12(14,15)9-19-5-7-20(8-6-19)11(18-16)17-10-3-1-2-4-10/h10H,1-9,16H2,(H,17,18).
What are the key properties of N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide?
N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide has a molecular weight of 293.34 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N'-cyclopentyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide is sourced from PubChem (CID 104885933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).