C11H22F3N5 — CID 104885935
N-amino-N'-(2-methylpropyl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide (PubChem CID 104885935) has the molecular formula C11H22F3N5 and a molecular weight of 281.33 g/mol. Its IUPAC name is N-amino-N'-(2-methylpropyl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide.
| Compound Name | N-amino-N'-(2-methylpropyl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 104885935 |
| Molecular Formula | C11H22F3N5 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N-amino-N'-(2-methylpropyl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
| SMILES | CC(C)C/N=C(\NN)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H22F3N5/c1-9(2)7-16-10(17-15)19-5-3-18(4-6-19)8-11(12,13)14/h9H,3-8,15H2,1-2H3,(H,16,17) |
| InChIKey | LYXHBZAMOGHUMU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|