C13H23N5O2 — CID 104887058
N-amino-N'-cyclohexyl-2,2-dimethyl-3,5-dioxopiperazine-1-carboximidamide (PubChem CID 104887058) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-amino-N'-cyclohexyl-2,2-dimethyl-3,5-dioxopiperazine-1-carboximidamide.
| Compound Name | N-amino-N'-cyclohexyl-2,2-dimethyl-3,5-dioxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 104887058 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-amino-N'-cyclohexyl-2,2-dimethyl-3,5-dioxopiperazine-1-carboximidamide |
| SMILES | CC1(C)C(=O)NC(=O)CN1/C(=N/C1CCCCC1)NN |
| InChI | InChI=1S/C13H23N5O2/c1-13(2)11(20)16-10(19)8-18(13)12(17-14)15-9-6-4-3-5-7-9/h9H,3-8,14H2,1-2H3,(H,15,17)(H,16,19,20) |
| InChIKey | ORSGQXMANKTLIN-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|