C14H29N5O2 — CID 104887197
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-amino-3-(3-ethoxypropyl)guanidine (PubChem CID 104887197) has the molecular formula C14H29N5O2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-amino-3-(3-ethoxypropyl)guanidine.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-amino-3-(3-ethoxypropyl)guanidine |
|---|---|
| PubChem CID | 104887197 |
| Molecular Formula | C14H29N5O2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-amino-3-(3-ethoxypropyl)guanidine |
| SMILES | CCOCCCN/C(=N\CC1CN2CCCC2CO1)NN |
| InChI | InChI=1S/C14H29N5O2/c1-2-20-8-4-6-16-14(18-15)17-9-13-10-19-7-3-5-12(19)11-21-13/h12-13H,2-11,15H2,1H3,(H2,16,17,18) |
| InChIKey | DHAGPIYQOHAKOF-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|