C10H24N4O2 — CID 104887482
3-amino-1-(2-ethoxyethyl)-2-(1-methoxypropan-2-yl)-1-methylguanidine (PubChem CID 104887482) has the molecular formula C10H24N4O2 and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-amino-1-(2-ethoxyethyl)-2-(1-methoxypropan-2-yl)-1-methylguanidine.
| Compound Name | 3-amino-1-(2-ethoxyethyl)-2-(1-methoxypropan-2-yl)-1-methylguanidine |
|---|---|
| PubChem CID | 104887482 |
| Molecular Formula | C10H24N4O2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 3-amino-1-(2-ethoxyethyl)-2-(1-methoxypropan-2-yl)-1-methylguanidine |
| SMILES | CCOCCN(C)/C(=N\C(C)COC)NN |
| InChI | InChI=1S/C10H24N4O2/c1-5-16-7-6-14(3)10(13-11)12-9(2)8-15-4/h9H,5-8,11H2,1-4H3,(H,12,13) |
| InChIKey | NPZQGODRFYCKFD-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|