C12H26N4 — CID 104887900
N-amino-N',2-dipropylpiperidine-1-carboximidamide (PubChem CID 104887900) has the molecular formula C12H26N4 and a molecular weight of 226.37 g/mol. Its IUPAC name is N-amino-N',2-dipropylpiperidine-1-carboximidamide.
| Compound Name | N-amino-N',2-dipropylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 104887900 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | N-amino-N',2-dipropylpiperidine-1-carboximidamide |
| SMILES | CCC/N=C(\NN)N1CCCCC1CCC |
| InChI | InChI=1S/C12H26N4/c1-3-7-11-8-5-6-10-16(11)12(15-13)14-9-4-2/h11H,3-10,13H2,1-2H3,(H,14,15) |
| InChIKey | FONKODLPEZEVRC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|