C11H18O4 — CID 10488808
(3S,3aR,6S,6aS)-6-butyl-4-hydroxy-3-methyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one (PubChem CID 10488808) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (3S,3aR,6S,6aS)-6-butyl-4-hydroxy-3-methyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one.
| Compound Name | (3S,3aR,6S,6aS)-6-butyl-4-hydroxy-3-methyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one |
|---|---|
| PubChem CID | 10488808 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (3S,3aR,6S,6aS)-6-butyl-4-hydroxy-3-methyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one |
| SMILES | CCCC[C@@H]1OC(O)[C@H]2[C@@H]1OC(=O)[C@H]2C |
| InChI | InChI=1S/C11H18O4/c1-3-4-5-7-9-8(11(13)14-7)6(2)10(12)15-9/h6-9,11,13H,3-5H2,1-2H3/t6-,7-,8+,9+,11?/m0/s1 |
| InChIKey | UBYZUNSHSRYBNP-DMSCBXGJSA-N |
| XLogP | 1.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |