C13H23N5S — CID 104888456
1-amino-2-cyclopentyl-3-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine (PubChem CID 104888456) has the molecular formula C13H23N5S and a molecular weight of 281.43 g/mol. Its IUPAC name is 1-amino-2-cyclopentyl-3-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine.
| Compound Name | 1-amino-2-cyclopentyl-3-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 104888456 |
| Molecular Formula | C13H23N5S |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-amino-2-cyclopentyl-3-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine |
| SMILES | CCc1cnc(C(C)N/C(=N/C2CCCC2)NN)s1 |
| InChI | InChI=1S/C13H23N5S/c1-3-11-8-15-12(19-11)9(2)16-13(18-14)17-10-6-4-5-7-10/h8-10H,3-7,14H2,1-2H3,(H2,16,17,18) |
| InChIKey | RONKYYKTSNYGTF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|