About 3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine
3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine (PubChem CID 104888977) has the molecular formula C7H16F2N4
and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine.
Molecular Properties
| Compound Name | 3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine |
| PubChem CID | 104888977 |
| Molecular Formula | C7H16F2N4 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine |
| SMILES | CCC/N=C(/NN)N(C)CC(F)F |
| InChI | InChI=1S/C7H16F2N4/c1-3-4-11-7(12-10)13(2)5-6(8)9/h6H,3-5,10H2,1-2H3,(H,11,12) |
| InChIKey | QAUDENJFHCZZHD-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine?
The IUPAC name of 3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine (CID 104888977) is 3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine.
What is the SMILES notation for 3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine?
The canonical SMILES for 3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine is CCC/N=C(/NN)N(C)CC(F)F.
What is the InChIKey of 3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine?
The InChIKey is QAUDENJFHCZZHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16F2N4/c1-3-4-11-7(12-10)13(2)5-6(8)9/h6H,3-5,10H2,1-2H3,(H,11,12).
What are the key properties of 3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine?
3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine has a molecular weight of 194.23 g/mol, XLogP of 0.41, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(2,2-difluoroethyl)-1-methyl-2-propylguanidine is sourced from PubChem (CID 104888977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).