C13H26N4O2 — CID 104889558
2-[4-[(5,5-dimethyloxolan-2-yl)methyl]piperazin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 104889558) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-[4-[(5,5-dimethyloxolan-2-yl)methyl]piperazin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4-[(5,5-dimethyloxolan-2-yl)methyl]piperazin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 104889558 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 2-[4-[(5,5-dimethyloxolan-2-yl)methyl]piperazin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | CC1(C)CCC(CN2CCN(CC(N)=NO)CC2)O1 |
| InChI | InChI=1S/C13H26N4O2/c1-13(2)4-3-11(19-13)9-16-5-7-17(8-6-16)10-12(14)15-18/h11,18H,3-10H2,1-2H3,(H2,14,15) |
| InChIKey | OMUMREKFTVCQJX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|