About 2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide
2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide (PubChem CID 104889565) has the molecular formula C14H27N3O2
and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide |
| PubChem CID | 104889565 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide |
| SMILES | CC1(C)CCC(CN(CC(N)=NO)C2CCCC2)O1 |
| InChI | InChI=1S/C14H27N3O2/c1-14(2)8-7-12(19-14)9-17(10-13(15)16-18)11-5-3-4-6-11/h11-12,18H,3-10H2,1-2H3,(H2,15,16) |
| InChIKey | SGMOMJVAARNCEX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide?
The IUPAC name of 2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide (CID 104889565) is 2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide?
The canonical SMILES for 2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide is CC1(C)CCC(CN(CC(N)=NO)C2CCCC2)O1.
What is the InChIKey of 2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide?
The InChIKey is SGMOMJVAARNCEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O2/c1-14(2)8-7-12(19-14)9-17(10-13(15)16-18)11-5-3-4-6-11/h11-12,18H,3-10H2,1-2H3,(H2,15,16).
What are the key properties of 2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide?
2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide has a molecular weight of 269.39 g/mol, XLogP of 1.93, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopentyl-[(5,5-dimethyloxolan-2-yl)methyl]amino]-N'-hydroxyethanimidamide is sourced from PubChem (CID 104889565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).