C19H29N — CID 104889638
(1S)-4,5,5,8,8-pentamethyl-1,2,3,4,6,7-hexahydroanthracen-1-amine (PubChem CID 104889638) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is (1S)-4,5,5,8,8-pentamethyl-1,2,3,4,6,7-hexahydroanthracen-1-amine.
| Compound Name | (1S)-4,5,5,8,8-pentamethyl-1,2,3,4,6,7-hexahydroanthracen-1-amine |
|---|---|
| PubChem CID | 104889638 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (1S)-4,5,5,8,8-pentamethyl-1,2,3,4,6,7-hexahydroanthracen-1-amine |
| SMILES | CC1CC[C@H](N)c2cc3c(cc21)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C19H29N/c1-12-6-7-17(20)14-11-16-15(10-13(12)14)18(2,3)8-9-19(16,4)5/h10-12,17H,6-9,20H2,1-5H3/t12?,17-/m0/s1 |
| InChIKey | FPKPYXNUZBLOQW-TYJDENFWSA-N |
| XLogP | 4.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |