About 2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane]
2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane] (PubChem CID 10488966) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane].
Molecular Properties
| Compound Name | 2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane] |
| PubChem CID | 10488966 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane] |
| SMILES | [O-][N+]1=Cc2ccccc2CC12CCOCC2 |
| InChI | InChI=1S/C13H15NO2/c15-14-10-12-4-2-1-3-11(12)9-13(14)5-7-16-8-6-13/h1-4,10H,5-9H2 |
| InChIKey | IXAUOFFTEQWJSV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane]?
The IUPAC name of 2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane] (CID 10488966) is 2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane].
What is the SMILES notation for 2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane]?
The canonical SMILES for 2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane] is [O-][N+]1=Cc2ccccc2CC12CCOCC2.
What is the InChIKey of 2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane]?
The InChIKey is IXAUOFFTEQWJSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c15-14-10-12-4-2-1-3-11(12)9-13(14)5-7-16-8-6-13/h1-4,10H,5-9H2.
What are the key properties of 2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane]?
2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane] has a molecular weight of 217.27 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxidospiro[4H-isoquinolin-2-ium-3,4'-oxane] is sourced from PubChem (CID 10488966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).