C12H14N2O2 — CID 10489002
3-(4-methoxy-2-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 10489002) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-(4-methoxy-2-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-(4-methoxy-2-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 10489002 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-(4-methoxy-2-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | COc1ccc(C2=NNC(=O)CC2)c(C)c1 |
| InChI | InChI=1S/C12H14N2O2/c1-8-7-9(16-2)3-4-10(8)11-5-6-12(15)14-13-11/h3-4,7H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | NXGOSSOTCJGSJB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |