About (6E)-9-bromonona-1,6-dien-3-ol
(6E)-9-bromonona-1,6-dien-3-ol (PubChem CID 10489037) has the molecular formula C9H15BrO
and a molecular weight of 219.12 g/mol. Its IUPAC name is (6E)-9-bromonona-1,6-dien-3-ol.
Molecular Properties
| Compound Name | (6E)-9-bromonona-1,6-dien-3-ol |
| PubChem CID | 10489037 |
| Molecular Formula | C9H15BrO |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | (6E)-9-bromonona-1,6-dien-3-ol |
| SMILES | C=CC(O)CC/C=C/CCBr |
| InChI | InChI=1S/C9H15BrO/c1-2-9(11)7-5-3-4-6-8-10/h2-4,9,11H,1,5-8H2/b4-3+ |
| InChIKey | IYGUWEFLZVJKPC-ONEGZZNKSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-9-bromonona-1,6-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-9-bromonona-1,6-dien-3-ol?
The IUPAC name of (6E)-9-bromonona-1,6-dien-3-ol (CID 10489037) is (6E)-9-bromonona-1,6-dien-3-ol.
What is the SMILES notation for (6E)-9-bromonona-1,6-dien-3-ol?
The canonical SMILES for (6E)-9-bromonona-1,6-dien-3-ol is C=CC(O)CC/C=C/CCBr.
What is the InChIKey of (6E)-9-bromonona-1,6-dien-3-ol?
The InChIKey is IYGUWEFLZVJKPC-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H15BrO/c1-2-9(11)7-5-3-4-6-8-10/h2-4,9,11H,1,5-8H2/b4-3+.
What are the key properties of (6E)-9-bromonona-1,6-dien-3-ol?
(6E)-9-bromonona-1,6-dien-3-ol has a molecular weight of 219.12 g/mol, XLogP of 2.65, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-9-bromonona-1,6-dien-3-ol is sourced from PubChem (CID 10489037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).