C11H23N3O2 — CID 104891523
N'-hydroxy-2-[2-(hydroxymethyl)azepan-1-yl]butanimidamide (PubChem CID 104891523) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is N'-hydroxy-2-[2-(hydroxymethyl)azepan-1-yl]butanimidamide.
| Compound Name | N'-hydroxy-2-[2-(hydroxymethyl)azepan-1-yl]butanimidamide |
|---|---|
| PubChem CID | 104891523 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N'-hydroxy-2-[2-(hydroxymethyl)azepan-1-yl]butanimidamide |
| SMILES | CCC(C(N)=NO)N1CCCCCC1CO |
| InChI | InChI=1S/C11H23N3O2/c1-2-10(11(12)13-16)14-7-5-3-4-6-9(14)8-15/h9-10,15-16H,2-8H2,1H3,(H2,12,13) |
| InChIKey | YPTVUEXPKNTETG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|