C14H22O2 — CID 10489226
(1Z,4aS,8aS)-1-(hydroxymethylidene)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-one (PubChem CID 10489226) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1Z,4aS,8aS)-1-(hydroxymethylidene)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | (1Z,4aS,8aS)-1-(hydroxymethylidene)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 10489226 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1Z,4aS,8aS)-1-(hydroxymethylidene)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-one |
| SMILES | CC1(C)CCC[C@]2(C)/C(=C/O)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C14H22O2/c1-13(2)7-4-8-14(3)10(9-15)11(16)5-6-12(13)14/h9,12,15H,4-8H2,1-3H3/b10-9+/t12-,14+/m0/s1 |
| InChIKey | SYMFXYDWORSDKZ-JMRXXTBOSA-N |
| XLogP | 3.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|