About (2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide
(2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide (PubChem CID 104893295) has the molecular formula C10H16N4O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is (2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide.
Molecular Properties
| Compound Name | (2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide |
| PubChem CID | 104893295 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide |
| SMILES | CC(C)(C)[C@@H](N)C(=O)Nc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C10H16N4O2/c1-10(2,3)8(11)9(16)12-6-4-5-7(15)14-13-6/h4-5,8H,11H2,1-3H3,(H,14,15)(H,12,13,16)/t8-/m0/s1 |
| InChIKey | LBEBOYKMTNDQAP-QMMMGPOBSA-N |
| XLogP | 0.08 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide?
The IUPAC name of (2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide (CID 104893295) is (2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide.
What is the SMILES notation for (2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide?
The canonical SMILES for (2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide is CC(C)(C)[C@@H](N)C(=O)Nc1ccc(=O)[nH]n1.
What is the InChIKey of (2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide?
The InChIKey is LBEBOYKMTNDQAP-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H16N4O2/c1-10(2,3)8(11)9(16)12-6-4-5-7(15)14-13-6/h4-5,8H,11H2,1-3H3,(H,14,15)(H,12,13,16)/t8-/m0/s1.
What are the key properties of (2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide?
(2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide has a molecular weight of 224.26 g/mol, XLogP of 0.08, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3,3-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)butanamide is sourced from PubChem (CID 104893295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).