C18H21BrO2 — CID 104893887
(1R)-1-[5-bromo-2-(4-phenylbutoxy)phenyl]ethanol (PubChem CID 104893887) has the molecular formula C18H21BrO2 and a molecular weight of 349.27 g/mol. Its IUPAC name is (1R)-1-[5-bromo-2-(4-phenylbutoxy)phenyl]ethanol.
| Compound Name | (1R)-1-[5-bromo-2-(4-phenylbutoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 104893887 |
| Molecular Formula | C18H21BrO2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (1R)-1-[5-bromo-2-(4-phenylbutoxy)phenyl]ethanol |
| SMILES | C[C@@H](O)c1cc(Br)ccc1OCCCCc1ccccc1 |
| InChI | InChI=1S/C18H21BrO2/c1-14(20)17-13-16(19)10-11-18(17)21-12-6-5-9-15-7-3-2-4-8-15/h2-4,7-8,10-11,13-14,20H,5-6,9,12H2,1H3/t14-/m1/s1 |
| InChIKey | FHPNVHZWJAFHCI-CQSZACIVSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|