C13H22O3 — CID 104893919
4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid (PubChem CID 104893919) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid.
| Compound Name | 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 104893919 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid |
| SMILES | CC(=CCOC1CCC(C)(C)CC1)C(=O)O |
| InChI | InChI=1S/C13H22O3/c1-10(12(14)15)6-9-16-11-4-7-13(2,3)8-5-11/h6,11H,4-5,7-9H2,1-3H3,(H,14,15) |
| InChIKey | SXRIJUZJVIGCMN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|