4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid

C13H22O3 — CID 104893919

IUPAC4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid
SMILESCC(=CCOC1CCC(C)(C)CC1)C(=O)O
InChIInChI=1S/C13H22O3/c1-10(12(14)15)6-9-16-11-4-7-13(2,3)8-5-11/h6,11H,4-5,7-9H2,1-3H3,(H,14,15)
InChIKeySXRIJUZJVIGCMN-UHFFFAOYSA-N
MW226.32 g/mol
LogP3.00
Rot. Bonds4

About 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid

4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid (PubChem CID 104893919) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid.

Molecular Properties

Compound Name4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid
PubChem CID104893919
Molecular FormulaC13H22O3
Molecular Weight226.32 g/mol
Exact Mass226.16
IUPAC Name4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid
SMILESCC(=CCOC1CCC(C)(C)CC1)C(=O)O
InChIInChI=1S/C13H22O3/c1-10(12(14)15)6-9-16-11-4-7-13(2,3)8-5-11/h6,11H,4-5,7-9H2,1-3H3,(H,14,15)
InChIKeySXRIJUZJVIGCMN-UHFFFAOYSA-N
XLogP3.00
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.32
LogP ≤ 53.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid?
The IUPAC name of 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid (CID 104893919) is 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid.
What is the SMILES notation for 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid?
The canonical SMILES for 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid is CC(=CCOC1CCC(C)(C)CC1)C(=O)O.
What is the InChIKey of 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid?
The InChIKey is SXRIJUZJVIGCMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3/c1-10(12(14)15)6-9-16-11-4-7-13(2,3)8-5-11/h6,11H,4-5,7-9H2,1-3H3,(H,14,15).
What are the key properties of 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid?
4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid has a molecular weight of 226.32 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylcyclohexyl)oxy-2-methylbut-2-enoic acid is sourced from PubChem (CID 104893919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).