C14H24N4O3 — CID 104894486
(2R)-2-[(6-amino-4-ethylhexanoyl)amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 104894486) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (2R)-2-[(6-amino-4-ethylhexanoyl)amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2R)-2-[(6-amino-4-ethylhexanoyl)amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 104894486 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (2R)-2-[(6-amino-4-ethylhexanoyl)amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CCC(CCN)CCC(=O)N[C@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C14H24N4O3/c1-2-10(5-6-15)3-4-13(19)18-12(14(20)21)7-11-8-16-9-17-11/h8-10,12H,2-7,15H2,1H3,(H,16,17)(H,18,19)(H,20,21)/t10?,12-/m1/s1 |
| InChIKey | PWJQZBSNDHJTJW-TVKKRMFBSA-N |
| XLogP | 0.68 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |