C11H14N4O3 — CID 104894521
(2R)-2-(2-aminopent-4-ynoylamino)-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 104894521) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is (2R)-2-(2-aminopent-4-ynoylamino)-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2R)-2-(2-aminopent-4-ynoylamino)-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 104894521 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (2R)-2-(2-aminopent-4-ynoylamino)-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | C#CCC(N)C(=O)N[C@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C11H14N4O3/c1-2-3-8(12)10(16)15-9(11(17)18)4-7-5-13-6-14-7/h1,5-6,8-9H,3-4,12H2,(H,13,14)(H,15,16)(H,17,18)/t8?,9-/m1/s1 |
| InChIKey | VYGZYUIGPSUNCR-YGPZHTELSA-N |
| XLogP | -1.13 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|