About S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate
S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate (PubChem CID 10489455) has the molecular formula C13H22OS
and a molecular weight of 226.38 g/mol. Its IUPAC name is S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate.
Molecular Properties
| Compound Name | S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate |
| PubChem CID | 10489455 |
| Molecular Formula | C13H22OS |
| Molecular Weight | 226.38 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate |
| SMILES | CC1=C(CC(=O)SC(C)C)CCC1(C)C |
| InChI | InChI=1S/C13H22OS/c1-9(2)15-12(14)8-11-6-7-13(4,5)10(11)3/h9H,6-8H2,1-5H3 |
| InChIKey | DOURVAUTHXKBAT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate?
The IUPAC name of S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate (CID 10489455) is S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate.
What is the SMILES notation for S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate?
The canonical SMILES for S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate is CC1=C(CC(=O)SC(C)C)CCC1(C)C.
What is the InChIKey of S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate?
The InChIKey is DOURVAUTHXKBAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22OS/c1-9(2)15-12(14)8-11-6-7-13(4,5)10(11)3/h9H,6-8H2,1-5H3.
What are the key properties of S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate?
S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate has a molecular weight of 226.38 g/mol, XLogP of 4.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-propan-2-yl 2-(2,3,3-trimethylcyclopenten-1-yl)ethanethioate is sourced from PubChem (CID 10489455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).