C10H20N4S — CID 10489552
3-N,5-N-di(butan-2-yl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 10489552) has the molecular formula C10H20N4S and a molecular weight of 228.36 g/mol. Its IUPAC name is 3-N,5-N-di(butan-2-yl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 3-N,5-N-di(butan-2-yl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 10489552 |
| Molecular Formula | C10H20N4S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-N,5-N-di(butan-2-yl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | CCC(C)Nc1nsc(NC(C)CC)n1 |
| InChI | InChI=1S/C10H20N4S/c1-5-7(3)11-9-13-10(15-14-9)12-8(4)6-2/h7-8H,5-6H2,1-4H3,(H2,11,12,13,14) |
| InChIKey | GXXYHPXROZQOGQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |