About 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal
4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal (PubChem CID 10489671) has the molecular formula C12H26O2Si
and a molecular weight of 230.42 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal.
Molecular Properties
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal |
| PubChem CID | 10489671 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal |
| SMILES | CC(C)(CC=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H26O2Si/c1-11(2,3)15(6,7)14-10-12(4,5)8-9-13/h9H,8,10H2,1-7H3 |
| InChIKey | YJOABQGAGJGYRO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal?
The IUPAC name of 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal (CID 10489671) is 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal.
What is the SMILES notation for 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal?
The canonical SMILES for 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal is CC(C)(CC=O)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal?
The InChIKey is YJOABQGAGJGYRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2Si/c1-11(2,3)15(6,7)14-10-12(4,5)8-9-13/h9H,8,10H2,1-7H3.
What are the key properties of 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal?
4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal has a molecular weight of 230.42 g/mol, XLogP of 3.62, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanal is sourced from PubChem (CID 10489671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).