C15H14ClN3O2 — CID 104897291
5-[[(2S)-2-amino-2-phenylacetyl]amino]-2-chlorobenzamide (PubChem CID 104897291) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is 5-[[(2S)-2-amino-2-phenylacetyl]amino]-2-chlorobenzamide.
| Compound Name | 5-[[(2S)-2-amino-2-phenylacetyl]amino]-2-chlorobenzamide |
|---|---|
| PubChem CID | 104897291 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 5-[[(2S)-2-amino-2-phenylacetyl]amino]-2-chlorobenzamide |
| SMILES | NC(=O)c1cc(NC(=O)[C@@H](N)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C15H14ClN3O2/c16-12-7-6-10(8-11(12)14(18)20)19-15(21)13(17)9-4-2-1-3-5-9/h1-8,13H,17H2,(H2,18,20)(H,19,21)/t13-/m0/s1 |
| InChIKey | DQNFTGWPDOFJEY-ZDUSSCGKSA-N |
| XLogP | 2.08 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |