C14H19NO2 — CID 10489832
N-(2,2,4,7-tetramethyl-3H-1-benzofuran-5-yl)acetamide (PubChem CID 10489832) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is N-(2,2,4,7-tetramethyl-3H-1-benzofuran-5-yl)acetamide.
| Compound Name | N-(2,2,4,7-tetramethyl-3H-1-benzofuran-5-yl)acetamide |
|---|---|
| PubChem CID | 10489832 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-(2,2,4,7-tetramethyl-3H-1-benzofuran-5-yl)acetamide |
| SMILES | CC(=O)Nc1cc(C)c2c(c1C)CC(C)(C)O2 |
| InChI | InChI=1S/C14H19NO2/c1-8-6-12(15-10(3)16)9(2)11-7-14(4,5)17-13(8)11/h6H,7H2,1-5H3,(H,15,16) |
| InChIKey | WHRBAXCDYBQLED-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |