C16H25N3O — CID 104899834
(1R)-1-[3-(3,5-dimethyl-1-adamantyl)-1,2,4-oxadiazol-5-yl]ethanamine (PubChem CID 104899834) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is (1R)-1-[3-(3,5-dimethyl-1-adamantyl)-1,2,4-oxadiazol-5-yl]ethanamine.
| Compound Name | (1R)-1-[3-(3,5-dimethyl-1-adamantyl)-1,2,4-oxadiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 104899834 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | (1R)-1-[3-(3,5-dimethyl-1-adamantyl)-1,2,4-oxadiazol-5-yl]ethanamine |
| SMILES | C[C@@H](N)c1nc(C23CC4CC(C)(CC(C)(C4)C2)C3)no1 |
| InChI | InChI=1S/C16H25N3O/c1-10(17)12-18-13(19-20-12)16-6-11-4-14(2,8-16)7-15(3,5-11)9-16/h10-11H,4-9,17H2,1-3H3/t10-,11?,14?,15?,16?/m1/s1 |
| InChIKey | ZXUBWRNFPBMUIJ-QDSVODFLSA-N |
| XLogP | 3.34 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |