C14H20O3 — CID 10489990
(1S,2R,5S,6S)-1-[(1S)-1-hydroxypropyl]-5-methyl-11-oxatricyclo[4.3.1.12,5]undec-3-en-10-one (PubChem CID 10489990) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1S,2R,5S,6S)-1-[(1S)-1-hydroxypropyl]-5-methyl-11-oxatricyclo[4.3.1.12,5]undec-3-en-10-one.
| Compound Name | (1S,2R,5S,6S)-1-[(1S)-1-hydroxypropyl]-5-methyl-11-oxatricyclo[4.3.1.12,5]undec-3-en-10-one |
|---|---|
| PubChem CID | 10489990 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1S,2R,5S,6S)-1-[(1S)-1-hydroxypropyl]-5-methyl-11-oxatricyclo[4.3.1.12,5]undec-3-en-10-one |
| SMILES | CC[C@H](O)[C@]12CCC[C@H](C1=O)[C@]1(C)C=C[C@H]2O1 |
| InChI | InChI=1S/C14H20O3/c1-3-10(15)14-7-4-5-9(12(14)16)13(2)8-6-11(14)17-13/h6,8-11,15H,3-5,7H2,1-2H3/t9-,10+,11-,13+,14+/m1/s1 |
| InChIKey | JPHXBLJEQDJMPJ-QXJJFIIZSA-N |
| XLogP | 1.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|