C10H11N5O — CID 104900783
3-pyrimidin-4-yl-5-[(2R)-pyrrolidin-2-yl]-1,2,4-oxadiazole (PubChem CID 104900783) has the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. Its IUPAC name is 3-pyrimidin-4-yl-5-[(2R)-pyrrolidin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-pyrimidin-4-yl-5-[(2R)-pyrrolidin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 104900783 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 3-pyrimidin-4-yl-5-[(2R)-pyrrolidin-2-yl]-1,2,4-oxadiazole |
| SMILES | c1cc(-c2noc([C@H]3CCCN3)n2)ncn1 |
| InChI | InChI=1S/C10H11N5O/c1-2-8(12-4-1)10-14-9(15-16-10)7-3-5-11-6-13-7/h3,5-6,8,12H,1-2,4H2/t8-/m1/s1 |
| InChIKey | SRYPLELYVMCXSA-MRVPVSSYSA-N |
| XLogP | 0.95 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |